C12H19F — CID 143588111
2,4-diethyl-1-fluorobenzene;ethane (PubChem CID 143588111) has the molecular formula C12H19F and a molecular weight of 182.28 g/mol. Its IUPAC name is 2,4-diethyl-1-fluorobenzene;ethane.
| Compound Name | 2,4-diethyl-1-fluorobenzene;ethane |
|---|---|
| PubChem CID | 143588111 |
| Molecular Formula | C12H19F |
| Molecular Weight | 182.28 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 2,4-diethyl-1-fluorobenzene;ethane |
| SMILES | CC.CCc1ccc(F)c(CC)c1 |
| InChI | InChI=1S/C10H13F.C2H6/c1-3-8-5-6-10(11)9(4-2)7-8;1-2/h5-7H,3-4H2,1-2H3;1-2H3 |
| InChIKey | FQEBAWCIGSHRSH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |