C8H8F2 — CID 23202513
2-ethyl-1,4-difluorobenzene (PubChem CID 23202513) has the molecular formula C8H8F2 and a molecular weight of 142.15 g/mol. Its IUPAC name is 2-ethyl-1,4-difluorobenzene.
| Compound Name | 2-ethyl-1,4-difluorobenzene |
|---|---|
| PubChem CID | 23202513 |
| Molecular Formula | C8H8F2 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 2-ethyl-1,4-difluorobenzene |
| SMILES | CCc1cc(F)ccc1F |
| InChI | InChI=1S/C8H8F2/c1-2-6-5-7(9)3-4-8(6)10/h3-5H,2H2,1H3 |
| InChIKey | SMWZLURIVGDUAU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |