C7H8F2N+ — CID 6951689
(2,5-difluorophenyl)methylazanium (PubChem CID 6951689) has the molecular formula C7H8F2N+ and a molecular weight of 144.14 g/mol. Its IUPAC name is (2,5-difluorophenyl)methylazanium.
| Compound Name | (2,5-difluorophenyl)methylazanium |
|---|---|
| PubChem CID | 6951689 |
| Molecular Formula | C7H8F2N+ |
| Molecular Weight | 144.14 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | (2,5-difluorophenyl)methylazanium |
| SMILES | [NH3+]Cc1cc(F)ccc1F |
| InChI | InChI=1S/C7H7F2N/c8-6-1-2-7(9)5(3-6)4-10/h1-3H,4,10H2/p+1 |
| InChIKey | GDFBHCMFIUBEQT-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.14 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |