C9H11F2N — CID 43163700
N-[(2,5-difluorophenyl)methyl]ethanamine (PubChem CID 43163700) has the molecular formula C9H11F2N and a molecular weight of 171.19 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]ethanamine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43163700 |
| Molecular Formula | C9H11F2N |
| Molecular Weight | 171.19 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]ethanamine |
| SMILES | CCNCc1cc(F)ccc1F |
| InChI | InChI=1S/C9H11F2N/c1-2-12-6-7-5-8(10)3-4-9(7)11/h3-5,12H,2,6H2,1H3 |
| InChIKey | JZHBSKFEBVCESD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |