C17H20FNO2 — CID 116810961
N-[[5-(2,6-dimethoxyphenyl)-2-fluorophenyl]methyl]ethanamine (PubChem CID 116810961) has the molecular formula C17H20FNO2 and a molecular weight of 289.35 g/mol. Its IUPAC name is N-[[5-(2,6-dimethoxyphenyl)-2-fluorophenyl]methyl]ethanamine.
| Compound Name | N-[[5-(2,6-dimethoxyphenyl)-2-fluorophenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 116810961 |
| Molecular Formula | C17H20FNO2 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-[[5-(2,6-dimethoxyphenyl)-2-fluorophenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(-c2c(OC)cccc2OC)ccc1F |
| InChI | InChI=1S/C17H20FNO2/c1-4-19-11-13-10-12(8-9-14(13)18)17-15(20-2)6-5-7-16(17)21-3/h5-10,19H,4,11H2,1-3H3 |
| InChIKey | CNTIJVZHQLKEQN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |