C8H7F2I — CID 147661564
1,4-difluoro-2-(2-iodoethyl)benzene (PubChem CID 147661564) has the molecular formula C8H7F2I and a molecular weight of 268.04 g/mol. Its IUPAC name is 1,4-difluoro-2-(2-iodoethyl)benzene.
| Compound Name | 1,4-difluoro-2-(2-iodoethyl)benzene |
|---|---|
| PubChem CID | 147661564 |
| Molecular Formula | C8H7F2I |
| Molecular Weight | 268.04 g/mol |
| Exact Mass | 267.96 |
| IUPAC Name | 1,4-difluoro-2-(2-iodoethyl)benzene |
| SMILES | Fc1ccc(F)c(CCI)c1 |
| InChI | InChI=1S/C8H7F2I/c9-7-1-2-8(10)6(5-7)3-4-11/h1-2,5H,3-4H2 |
| InChIKey | GLLQYULFCVGULN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.04 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|