C10H14F2N2 — CID 115195405
N'-[2-(2,5-difluorophenyl)ethyl]ethane-1,2-diamine (PubChem CID 115195405) has the molecular formula C10H14F2N2 and a molecular weight of 200.23 g/mol. Its IUPAC name is N'-[2-(2,5-difluorophenyl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(2,5-difluorophenyl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 115195405 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | N'-[2-(2,5-difluorophenyl)ethyl]ethane-1,2-diamine |
| SMILES | NCCNCCc1cc(F)ccc1F |
| InChI | InChI=1S/C10H14F2N2/c11-9-1-2-10(12)8(7-9)3-5-14-6-4-13/h1-2,7,14H,3-6,13H2 |
| InChIKey | RHTSYBUNHVXZRV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|