C12H15F2NO — CID 115235909
4-[2-(2,5-difluorophenyl)ethylamino]butan-2-one (PubChem CID 115235909) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is 4-[2-(2,5-difluorophenyl)ethylamino]butan-2-one.
| Compound Name | 4-[2-(2,5-difluorophenyl)ethylamino]butan-2-one |
|---|---|
| PubChem CID | 115235909 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-[2-(2,5-difluorophenyl)ethylamino]butan-2-one |
| SMILES | CC(=O)CCNCCc1cc(F)ccc1F |
| InChI | InChI=1S/C12H15F2NO/c1-9(16)4-6-15-7-5-10-8-11(13)2-3-12(10)14/h2-3,8,15H,4-7H2,1H3 |
| InChIKey | CLSVWOHBDYWMCP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|