C9H12F2N2 — CID 115226055
N'-[2-(2,4-difluorophenyl)ethyl]methanediamine (PubChem CID 115226055) has the molecular formula C9H12F2N2 and a molecular weight of 186.21 g/mol. Its IUPAC name is N'-[2-(2,4-difluorophenyl)ethyl]methanediamine.
| Compound Name | N'-[2-(2,4-difluorophenyl)ethyl]methanediamine |
|---|---|
| PubChem CID | 115226055 |
| Molecular Formula | C9H12F2N2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | N'-[2-(2,4-difluorophenyl)ethyl]methanediamine |
| SMILES | NCNCCc1ccc(F)cc1F |
| InChI | InChI=1S/C9H12F2N2/c10-8-2-1-7(9(11)5-8)3-4-13-6-12/h1-2,5,13H,3-4,6,12H2 |
| InChIKey | VTMMXWXTIULKGH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|