C14H20F2N2 — CID 115245915
N-[[1-(aminomethyl)cyclobutyl]methyl]-2-(2,4-difluorophenyl)ethanamine (PubChem CID 115245915) has the molecular formula C14H20F2N2 and a molecular weight of 254.32 g/mol. Its IUPAC name is N-[[1-(aminomethyl)cyclobutyl]methyl]-2-(2,4-difluorophenyl)ethanamine.
| Compound Name | N-[[1-(aminomethyl)cyclobutyl]methyl]-2-(2,4-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 115245915 |
| Molecular Formula | C14H20F2N2 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N-[[1-(aminomethyl)cyclobutyl]methyl]-2-(2,4-difluorophenyl)ethanamine |
| SMILES | NCC1(CNCCc2ccc(F)cc2F)CCC1 |
| InChI | InChI=1S/C14H20F2N2/c15-12-3-2-11(13(16)8-12)4-7-18-10-14(9-17)5-1-6-14/h2-3,8,18H,1,4-7,9-10,17H2 |
| InChIKey | KABHMLVZLDIDMD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|