C14H22F2N2 — CID 115204562
N-[2-(2,4-difluorophenyl)ethyl]-2,2-dimethylbutane-1,4-diamine (PubChem CID 115204562) has the molecular formula C14H22F2N2 and a molecular weight of 256.34 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)ethyl]-2,2-dimethylbutane-1,4-diamine.
| Compound Name | N-[2-(2,4-difluorophenyl)ethyl]-2,2-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115204562 |
| Molecular Formula | C14H22F2N2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)ethyl]-2,2-dimethylbutane-1,4-diamine |
| SMILES | CC(C)(CCN)CNCCc1ccc(F)cc1F |
| InChI | InChI=1S/C14H22F2N2/c1-14(2,6-7-17)10-18-8-5-11-3-4-12(15)9-13(11)16/h3-4,9,18H,5-8,10,17H2,1-2H3 |
| InChIKey | YUZOSRWAFVXKCX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|