C17H26FNO — CID 81418469
[1-[[2-(4-fluoro-2-methylphenyl)ethylamino]methyl]cyclohexyl]methanol (PubChem CID 81418469) has the molecular formula C17H26FNO and a molecular weight of 279.40 g/mol. Its IUPAC name is [1-[[2-(4-fluoro-2-methylphenyl)ethylamino]methyl]cyclohexyl]methanol.
| Compound Name | [1-[[2-(4-fluoro-2-methylphenyl)ethylamino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 81418469 |
| Molecular Formula | C17H26FNO |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | [1-[[2-(4-fluoro-2-methylphenyl)ethylamino]methyl]cyclohexyl]methanol |
| SMILES | Cc1cc(F)ccc1CCNCC1(CO)CCCCC1 |
| InChI | InChI=1S/C17H26FNO/c1-14-11-16(18)6-5-15(14)7-10-19-12-17(13-20)8-3-2-4-9-17/h5-6,11,19-20H,2-4,7-10,12-13H2,1H3 |
| InChIKey | VVZKLMKSQHHVKF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|