C12H16F2N2O2 — CID 115241335
2-amino-4-[2-(2,4-difluorophenyl)ethylamino]butanoic acid (PubChem CID 115241335) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-amino-4-[2-(2,4-difluorophenyl)ethylamino]butanoic acid.
| Compound Name | 2-amino-4-[2-(2,4-difluorophenyl)ethylamino]butanoic acid |
|---|---|
| PubChem CID | 115241335 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-amino-4-[2-(2,4-difluorophenyl)ethylamino]butanoic acid |
| SMILES | NC(CCNCCc1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C12H16F2N2O2/c13-9-2-1-8(10(14)7-9)3-5-16-6-4-11(15)12(17)18/h1-2,7,11,16H,3-6,15H2,(H,17,18) |
| InChIKey | VUGPDSNAAPNDNN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|