4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid

C14H19F2NO2 — CID 122035922

IUPAC4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid
SMILESCC(CCc1ccc(F)cc1F)NCCCC(=O)O
InChIInChI=1S/C14H19F2NO2/c1-10(17-8-2-3-14(18)19)4-5-11-6-7-12(15)9-13(11)16/h6-7,9-10,17H,2-5,8H2,1H3,(H,18,19)
InChIKeyFJRQAWGMBGBKSE-UHFFFAOYSA-N
MW271.31 g/mol
LogP2.74
Rot. Bonds8

About 4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid

4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid (PubChem CID 122035922) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid.

Molecular Properties

Compound Name4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid
PubChem CID122035922
Molecular FormulaC14H19F2NO2
Molecular Weight271.31 g/mol
Exact Mass271.14
IUPAC Name4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid
SMILESCC(CCc1ccc(F)cc1F)NCCCC(=O)O
InChIInChI=1S/C14H19F2NO2/c1-10(17-8-2-3-14(18)19)4-5-11-6-7-12(15)9-13(11)16/h6-7,9-10,17H,2-5,8H2,1H3,(H,18,19)
InChIKeyFJRQAWGMBGBKSE-UHFFFAOYSA-N
XLogP2.74
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.31
LogP ≤ 52.74
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid?
The IUPAC name of 4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid (CID 122035922) is 4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid.
What is the SMILES notation for 4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid?
The canonical SMILES for 4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid is CC(CCc1ccc(F)cc1F)NCCCC(=O)O.
What is the InChIKey of 4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid?
The InChIKey is FJRQAWGMBGBKSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F2NO2/c1-10(17-8-2-3-14(18)19)4-5-11-6-7-12(15)9-13(11)16/h6-7,9-10,17H,2-5,8H2,1H3,(H,18,19).
What are the key properties of 4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid?
4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid has a molecular weight of 271.31 g/mol, XLogP of 2.74, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,4-difluorophenyl)butan-2-ylamino]butanoic acid is sourced from PubChem (CID 122035922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).