C13H13F2NO — CID 78955642
2-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)ethanamine (PubChem CID 78955642) has the molecular formula C13H13F2NO and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)ethanamine.
| Compound Name | 2-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 78955642 |
| Molecular Formula | C13H13F2NO |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-(2,4-difluorophenyl)-N-(furan-2-ylmethyl)ethanamine |
| SMILES | Fc1ccc(CCNCc2ccco2)c(F)c1 |
| InChI | InChI=1S/C13H13F2NO/c14-11-4-3-10(13(15)8-11)5-6-16-9-12-2-1-7-17-12/h1-4,7-8,16H,5-6,9H2 |
| InChIKey | PZNXCZWXLNQVRD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|