C13H15ClFNO — CID 17331094
2-(2-fluorophenyl)-N-(furan-2-ylmethyl)ethanamine;hydrochloride (PubChem CID 17331094) has the molecular formula C13H15ClFNO and a molecular weight of 255.72 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-(furan-2-ylmethyl)ethanamine;hydrochloride.
| Compound Name | 2-(2-fluorophenyl)-N-(furan-2-ylmethyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17331094 |
| Molecular Formula | C13H15ClFNO |
| Molecular Weight | 255.72 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-(2-fluorophenyl)-N-(furan-2-ylmethyl)ethanamine;hydrochloride |
| SMILES | Cl.Fc1ccccc1CCNCc1ccco1 |
| InChI | InChI=1S/C13H14FNO.ClH/c14-13-6-2-1-4-11(13)7-8-15-10-12-5-3-9-16-12;/h1-6,9,15H,7-8,10H2;1H |
| InChIKey | MLQYEFZWBOKLDZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.72 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|