C13H13F2NO2 — CID 62573014
2-(2,4-difluorophenoxy)-N-(furan-2-ylmethyl)ethanamine (PubChem CID 62573014) has the molecular formula C13H13F2NO2 and a molecular weight of 253.25 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-N-(furan-2-ylmethyl)ethanamine.
| Compound Name | 2-(2,4-difluorophenoxy)-N-(furan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 62573014 |
| Molecular Formula | C13H13F2NO2 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-N-(furan-2-ylmethyl)ethanamine |
| SMILES | Fc1ccc(OCCNCc2ccco2)c(F)c1 |
| InChI | InChI=1S/C13H13F2NO2/c14-10-3-4-13(12(15)8-10)18-7-5-16-9-11-2-1-6-17-11/h1-4,6,8,16H,5,7,9H2 |
| InChIKey | KITKETJGFZDOOV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|