C14H21F2NO2 — CID 55088257
2-butoxy-N-[2-(2,4-difluorophenoxy)ethyl]ethanamine (PubChem CID 55088257) has the molecular formula C14H21F2NO2 and a molecular weight of 273.32 g/mol. Its IUPAC name is 2-butoxy-N-[2-(2,4-difluorophenoxy)ethyl]ethanamine.
| Compound Name | 2-butoxy-N-[2-(2,4-difluorophenoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 55088257 |
| Molecular Formula | C14H21F2NO2 |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-butoxy-N-[2-(2,4-difluorophenoxy)ethyl]ethanamine |
| SMILES | CCCCOCCNCCOc1ccc(F)cc1F |
| InChI | InChI=1S/C14H21F2NO2/c1-2-3-8-18-9-6-17-7-10-19-14-5-4-12(15)11-13(14)16/h4-5,11,17H,2-3,6-10H2,1H3 |
| InChIKey | BUKMLXYKVZYUES-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|