C14H18F2N2 — CID 115254633
2-[[2-(2,4-difluorophenyl)ethylamino]methyl]-3-methylbutanenitrile (PubChem CID 115254633) has the molecular formula C14H18F2N2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[[2-(2,4-difluorophenyl)ethylamino]methyl]-3-methylbutanenitrile.
| Compound Name | 2-[[2-(2,4-difluorophenyl)ethylamino]methyl]-3-methylbutanenitrile |
|---|---|
| PubChem CID | 115254633 |
| Molecular Formula | C14H18F2N2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-[[2-(2,4-difluorophenyl)ethylamino]methyl]-3-methylbutanenitrile |
| SMILES | CC(C)C(C#N)CNCCc1ccc(F)cc1F |
| InChI | InChI=1S/C14H18F2N2/c1-10(2)12(8-17)9-18-6-5-11-3-4-13(15)7-14(11)16/h3-4,7,10,12,18H,5-6,9H2,1-2H3 |
| InChIKey | YHWLNRORDLTFCB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|