C15H11F3N2 — CID 133302391
4-[2-(2,4-difluorophenyl)ethylamino]-3-fluorobenzonitrile (PubChem CID 133302391) has the molecular formula C15H11F3N2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 4-[2-(2,4-difluorophenyl)ethylamino]-3-fluorobenzonitrile.
| Compound Name | 4-[2-(2,4-difluorophenyl)ethylamino]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 133302391 |
| Molecular Formula | C15H11F3N2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-[2-(2,4-difluorophenyl)ethylamino]-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(NCCc2ccc(F)cc2F)c(F)c1 |
| InChI | InChI=1S/C15H11F3N2/c16-12-3-2-11(13(17)8-12)5-6-20-15-4-1-10(9-19)7-14(15)18/h1-4,7-8,20H,5-6H2 |
| InChIKey | XZIUQKBABCBWBX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |