C13H14F4N2 — CID 103367404
3,3,3-trifluoro-2-[[2-(4-fluoro-2-methylphenyl)ethylamino]methyl]propanenitrile (PubChem CID 103367404) has the molecular formula C13H14F4N2 and a molecular weight of 274.26 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[2-(4-fluoro-2-methylphenyl)ethylamino]methyl]propanenitrile.
| Compound Name | 3,3,3-trifluoro-2-[[2-(4-fluoro-2-methylphenyl)ethylamino]methyl]propanenitrile |
|---|---|
| PubChem CID | 103367404 |
| Molecular Formula | C13H14F4N2 |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3,3,3-trifluoro-2-[[2-(4-fluoro-2-methylphenyl)ethylamino]methyl]propanenitrile |
| SMILES | Cc1cc(F)ccc1CCNCC(C#N)C(F)(F)F |
| InChI | InChI=1S/C13H14F4N2/c1-9-6-12(14)3-2-10(9)4-5-19-8-11(7-18)13(15,16)17/h2-3,6,11,19H,4-5,8H2,1H3 |
| InChIKey | UTWUBCWFWFXMPA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|