C10H10F5N — CID 117046746
4-(2,5-difluorophenyl)-1,1,1-trifluorobutan-2-amine (PubChem CID 117046746) has the molecular formula C10H10F5N and a molecular weight of 239.19 g/mol. Its IUPAC name is 4-(2,5-difluorophenyl)-1,1,1-trifluorobutan-2-amine.
| Compound Name | 4-(2,5-difluorophenyl)-1,1,1-trifluorobutan-2-amine |
|---|---|
| PubChem CID | 117046746 |
| Molecular Formula | C10H10F5N |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 4-(2,5-difluorophenyl)-1,1,1-trifluorobutan-2-amine |
| SMILES | NC(CCc1cc(F)ccc1F)C(F)(F)F |
| InChI | InChI=1S/C10H10F5N/c11-7-2-3-8(12)6(5-7)1-4-9(16)10(13,14)15/h2-3,5,9H,1,4,16H2 |
| InChIKey | OHEODQFCGNOSEB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |