C9H7F2N — CID 83480699
1,4-difluoro-2-(2-isocyanoethyl)benzene (PubChem CID 83480699) has the molecular formula C9H7F2N and a molecular weight of 167.16 g/mol. Its IUPAC name is 1,4-difluoro-2-(2-isocyanoethyl)benzene.
| Compound Name | 1,4-difluoro-2-(2-isocyanoethyl)benzene |
|---|---|
| PubChem CID | 83480699 |
| Molecular Formula | C9H7F2N |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 1,4-difluoro-2-(2-isocyanoethyl)benzene |
| SMILES | [C-]#[N+]CCc1cc(F)ccc1F |
| InChI | InChI=1S/C9H7F2N/c1-12-5-4-7-6-8(10)2-3-9(7)11/h2-3,6H,4-5H2 |
| InChIKey | UFUWWZPJJKHKSX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|