C16H26F2 — CID 144692824
2-ethyl-1,4-difluorobenzene;octane (PubChem CID 144692824) has the molecular formula C16H26F2 and a molecular weight of 256.38 g/mol. Its IUPAC name is 2-ethyl-1,4-difluorobenzene;octane.
| Compound Name | 2-ethyl-1,4-difluorobenzene;octane |
|---|---|
| PubChem CID | 144692824 |
| Molecular Formula | C16H26F2 |
| Molecular Weight | 256.38 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 2-ethyl-1,4-difluorobenzene;octane |
| SMILES | CCCCCCCC.CCc1cc(F)ccc1F |
| InChI | InChI=1S/C8H8F2.C8H18/c1-2-6-5-7(9)3-4-8(6)10;1-3-5-7-8-6-4-2/h3-5H,2H2,1H3;3-8H2,1-2H3 |
| InChIKey | XJYFLJDMTBPCAP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.38 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|