C18H26F2O — CID 65448171
1-(2,5-difluorophenyl)dodecan-1-one (PubChem CID 65448171) has the molecular formula C18H26F2O and a molecular weight of 296.40 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)dodecan-1-one.
| Compound Name | 1-(2,5-difluorophenyl)dodecan-1-one |
|---|---|
| PubChem CID | 65448171 |
| Molecular Formula | C18H26F2O |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 1-(2,5-difluorophenyl)dodecan-1-one |
| SMILES | CCCCCCCCCCCC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C18H26F2O/c1-2-3-4-5-6-7-8-9-10-11-18(21)16-14-15(19)12-13-17(16)20/h12-14H,2-11H2,1H3 |
| InChIKey | QTQOXMOXPFDUJF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|