C20H18Cl2F4O2 — CID 175501852
4-chloro-1-(2,5-difluorophenyl)butan-1-one (PubChem CID 175501852) has the molecular formula C20H18Cl2F4O2 and a molecular weight of 437.26 g/mol. Its IUPAC name is 4-chloro-1-(2,5-difluorophenyl)butan-1-one.
| Compound Name | 4-chloro-1-(2,5-difluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 175501852 |
| Molecular Formula | C20H18Cl2F4O2 |
| Molecular Weight | 437.26 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 4-chloro-1-(2,5-difluorophenyl)butan-1-one |
| SMILES | O=C(CCCCl)c1cc(F)ccc1F.O=C(CCCCl)c1cc(F)ccc1F |
| InChI | InChI=1S/2C10H9ClF2O/c2*11-5-1-2-10(14)8-6-7(12)3-4-9(8)13/h2*3-4,6H,1-2,5H2 |
| InChIKey | RERSEHPOEDPMGW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.26 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|