C13H15F2NO2 — CID 94271165
5-(2,5-difluorophenyl)-N-ethyl-5-oxopentanamide (PubChem CID 94271165) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-N-ethyl-5-oxopentanamide.
| Compound Name | 5-(2,5-difluorophenyl)-N-ethyl-5-oxopentanamide |
|---|---|
| PubChem CID | 94271165 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 5-(2,5-difluorophenyl)-N-ethyl-5-oxopentanamide |
| SMILES | CCNC(=O)CCCC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H15F2NO2/c1-2-16-13(18)5-3-4-12(17)10-8-9(14)6-7-11(10)15/h6-8H,2-5H2,1H3,(H,16,18) |
| InChIKey | NHGWMSGUKSKYCM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |