C10H10ClF2NO — CID 43133472
N-(3-chloropropyl)-2,5-difluorobenzamide (PubChem CID 43133472) has the molecular formula C10H10ClF2NO and a molecular weight of 233.64 g/mol. Its IUPAC name is N-(3-chloropropyl)-2,5-difluorobenzamide.
| Compound Name | N-(3-chloropropyl)-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 43133472 |
| Molecular Formula | C10H10ClF2NO |
| Molecular Weight | 233.64 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | N-(3-chloropropyl)-2,5-difluorobenzamide |
| SMILES | O=C(NCCCCl)c1cc(F)ccc1F |
| InChI | InChI=1S/C10H10ClF2NO/c11-4-1-5-14-10(15)8-6-7(12)2-3-9(8)13/h2-3,6H,1,4-5H2,(H,14,15) |
| InChIKey | QQVBLNNBAYGKEZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.64 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|