C16H21F3O — CID 103301401
1-(2,4,5-trifluorophenyl)decan-1-one (PubChem CID 103301401) has the molecular formula C16H21F3O and a molecular weight of 286.34 g/mol. Its IUPAC name is 1-(2,4,5-trifluorophenyl)decan-1-one.
| Compound Name | 1-(2,4,5-trifluorophenyl)decan-1-one |
|---|---|
| PubChem CID | 103301401 |
| Molecular Formula | C16H21F3O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-(2,4,5-trifluorophenyl)decan-1-one |
| SMILES | CCCCCCCCCC(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H21F3O/c1-2-3-4-5-6-7-8-9-16(20)12-10-14(18)15(19)11-13(12)17/h10-11H,2-9H2,1H3 |
| InChIKey | WUOPSPBRVUWHME-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|