C11H11ClF2O — CID 15001812
1-(2-chloro-4,5-difluorophenyl)pentan-1-one (PubChem CID 15001812) has the molecular formula C11H11ClF2O and a molecular weight of 232.66 g/mol. Its IUPAC name is 1-(2-chloro-4,5-difluorophenyl)pentan-1-one.
| Compound Name | 1-(2-chloro-4,5-difluorophenyl)pentan-1-one |
|---|---|
| PubChem CID | 15001812 |
| Molecular Formula | C11H11ClF2O |
| Molecular Weight | 232.66 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1-(2-chloro-4,5-difluorophenyl)pentan-1-one |
| SMILES | CCCCC(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C11H11ClF2O/c1-2-3-4-11(15)7-5-9(13)10(14)6-8(7)12/h5-6H,2-4H2,1H3 |
| InChIKey | NHKKUKXKOIUCIS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.66 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|