C17H25ClO — CID 115483569
1-(2-chloro-4,5-dimethylphenyl)nonan-1-one (PubChem CID 115483569) has the molecular formula C17H25ClO and a molecular weight of 280.84 g/mol. Its IUPAC name is 1-(2-chloro-4,5-dimethylphenyl)nonan-1-one.
| Compound Name | 1-(2-chloro-4,5-dimethylphenyl)nonan-1-one |
|---|---|
| PubChem CID | 115483569 |
| Molecular Formula | C17H25ClO |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-(2-chloro-4,5-dimethylphenyl)nonan-1-one |
| SMILES | CCCCCCCCC(=O)c1cc(C)c(C)cc1Cl |
| InChI | InChI=1S/C17H25ClO/c1-4-5-6-7-8-9-10-17(19)15-11-13(2)14(3)12-16(15)18/h11-12H,4-10H2,1-3H3 |
| InChIKey | FGEWODDMCDEAAR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|