C13H17ClO — CID 83957886
1-(2-chloro-4,5-dimethylphenyl)pentan-1-one (PubChem CID 83957886) has the molecular formula C13H17ClO and a molecular weight of 224.73 g/mol. Its IUPAC name is 1-(2-chloro-4,5-dimethylphenyl)pentan-1-one.
| Compound Name | 1-(2-chloro-4,5-dimethylphenyl)pentan-1-one |
|---|---|
| PubChem CID | 83957886 |
| Molecular Formula | C13H17ClO |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-(2-chloro-4,5-dimethylphenyl)pentan-1-one |
| SMILES | CCCCC(=O)c1cc(C)c(C)cc1Cl |
| InChI | InChI=1S/C13H17ClO/c1-4-5-6-13(15)11-7-9(2)10(3)8-12(11)14/h7-8H,4-6H2,1-3H3 |
| InChIKey | SELBKUSMXQWPNB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |