C8H7F2NO — CID 21245498
2-(2,5-difluorophenyl)acetamide (PubChem CID 21245498) has the molecular formula C8H7F2NO and a molecular weight of 171.15 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)acetamide.
| Compound Name | 2-(2,5-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 21245498 |
| Molecular Formula | C8H7F2NO |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 2-(2,5-difluorophenyl)acetamide |
| SMILES | NC(=O)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C8H7F2NO/c9-6-1-2-7(10)5(3-6)4-8(11)12/h1-3H,4H2,(H2,11,12) |
| InChIKey | AFRVJOJZPPTVFW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |