C8H5ClF2O2 — CID 83820147
(2,5-difluorophenyl)methyl carbonochloridate (PubChem CID 83820147) has the molecular formula C8H5ClF2O2 and a molecular weight of 206.57 g/mol. Its IUPAC name is (2,5-difluorophenyl)methyl carbonochloridate.
| Compound Name | (2,5-difluorophenyl)methyl carbonochloridate |
|---|---|
| PubChem CID | 83820147 |
| Molecular Formula | C8H5ClF2O2 |
| Molecular Weight | 206.57 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | (2,5-difluorophenyl)methyl carbonochloridate |
| SMILES | O=C(Cl)OCc1cc(F)ccc1F |
| InChI | InChI=1S/C8H5ClF2O2/c9-8(12)13-4-5-3-6(10)1-2-7(5)11/h1-3H,4H2 |
| InChIKey | MJBWXAHNRDNMOZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.57 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|