C13H13F2NO — CID 116584834
1-(4-aminocyclopent-2-en-1-yl)-2-(2,5-difluorophenyl)ethanone (PubChem CID 116584834) has the molecular formula C13H13F2NO and a molecular weight of 237.25 g/mol. Its IUPAC name is 1-(4-aminocyclopent-2-en-1-yl)-2-(2,5-difluorophenyl)ethanone.
| Compound Name | 1-(4-aminocyclopent-2-en-1-yl)-2-(2,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 116584834 |
| Molecular Formula | C13H13F2NO |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 1-(4-aminocyclopent-2-en-1-yl)-2-(2,5-difluorophenyl)ethanone |
| SMILES | NC1C=CC(C(=O)Cc2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C13H13F2NO/c14-10-2-4-12(15)9(5-10)7-13(17)8-1-3-11(16)6-8/h1-5,8,11H,6-7,16H2 |
| InChIKey | YENVAVFGRYHTQZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|