C13H13ClFNO — CID 116584926
1-(4-aminocyclopent-2-en-1-yl)-2-(2-chloro-4-fluorophenyl)ethanone (PubChem CID 116584926) has the molecular formula C13H13ClFNO and a molecular weight of 253.70 g/mol. Its IUPAC name is 1-(4-aminocyclopent-2-en-1-yl)-2-(2-chloro-4-fluorophenyl)ethanone.
| Compound Name | 1-(4-aminocyclopent-2-en-1-yl)-2-(2-chloro-4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 116584926 |
| Molecular Formula | C13H13ClFNO |
| Molecular Weight | 253.70 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 1-(4-aminocyclopent-2-en-1-yl)-2-(2-chloro-4-fluorophenyl)ethanone |
| SMILES | NC1C=CC(C(=O)Cc2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C13H13ClFNO/c14-12-7-10(15)3-1-8(12)6-13(17)9-2-4-11(16)5-9/h1-4,7,9,11H,5-6,16H2 |
| InChIKey | KLNVEENAQINBQH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.70 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|