C9H10ClF2N3O2 — CID 19360584
(2,5-difluorophenyl)methyl N-(diaminomethylidene)carbamate;hydrochloride (PubChem CID 19360584) has the molecular formula C9H10ClF2N3O2 and a molecular weight of 265.65 g/mol. Its IUPAC name is (2,5-difluorophenyl)methyl N-(diaminomethylidene)carbamate;hydrochloride.
| Compound Name | (2,5-difluorophenyl)methyl N-(diaminomethylidene)carbamate;hydrochloride |
|---|---|
| PubChem CID | 19360584 |
| Molecular Formula | C9H10ClF2N3O2 |
| Molecular Weight | 265.65 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | (2,5-difluorophenyl)methyl N-(diaminomethylidene)carbamate;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)OCc1cc(F)ccc1F |
| InChI | InChI=1S/C9H9F2N3O2.ClH/c10-6-1-2-7(11)5(3-6)4-16-9(15)14-8(12)13;/h1-3H,4H2,(H4,12,13,14,15);1H |
| InChIKey | JSLYYHPOYAYOCZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.65 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|