C8H7F2N3O — CID 84551330
N-(diaminomethylidene)-2,5-difluorobenzamide (PubChem CID 84551330) has the molecular formula C8H7F2N3O and a molecular weight of 199.16 g/mol. Its IUPAC name is N-(diaminomethylidene)-2,5-difluorobenzamide.
| Compound Name | N-(diaminomethylidene)-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 84551330 |
| Molecular Formula | C8H7F2N3O |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | N-(diaminomethylidene)-2,5-difluorobenzamide |
| SMILES | NC(N)=NC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C8H7F2N3O/c9-4-1-2-6(10)5(3-4)7(14)13-8(11)12/h1-3H,(H4,11,12,13,14) |
| InChIKey | GSXUIROHGRAKLI-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|