C9H8ClF4N3O — CID 23212872
N-(diaminomethylidene)-2-fluoro-5-(trifluoromethyl)benzamide;hydrochloride (PubChem CID 23212872) has the molecular formula C9H8ClF4N3O and a molecular weight of 285.63 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-fluoro-5-(trifluoromethyl)benzamide;hydrochloride.
| Compound Name | N-(diaminomethylidene)-2-fluoro-5-(trifluoromethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 23212872 |
| Molecular Formula | C9H8ClF4N3O |
| Molecular Weight | 285.63 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | N-(diaminomethylidene)-2-fluoro-5-(trifluoromethyl)benzamide;hydrochloride |
| SMILES | Cl.NC(N)=NC(=O)c1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C9H7F4N3O.ClH/c10-6-2-1-4(9(11,12)13)3-5(6)7(17)16-8(14)15;/h1-3H,(H4,14,15,16,17);1H |
| InChIKey | VDANVNYFIKDZAP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.63 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|