C10H10Cl2F3N3O — CID 22446891
2-chloro-N-(diaminomethylidene)-3-methyl-5-(trifluoromethyl)benzamide;hydrochloride (PubChem CID 22446891) has the molecular formula C10H10Cl2F3N3O and a molecular weight of 316.11 g/mol. Its IUPAC name is 2-chloro-N-(diaminomethylidene)-3-methyl-5-(trifluoromethyl)benzamide;hydrochloride.
| Compound Name | 2-chloro-N-(diaminomethylidene)-3-methyl-5-(trifluoromethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 22446891 |
| Molecular Formula | C10H10Cl2F3N3O |
| Molecular Weight | 316.11 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 2-chloro-N-(diaminomethylidene)-3-methyl-5-(trifluoromethyl)benzamide;hydrochloride |
| SMILES | Cc1cc(C(F)(F)F)cc(C(=O)N=C(N)N)c1Cl.Cl |
| InChI | InChI=1S/C10H9ClF3N3O.ClH/c1-4-2-5(10(12,13)14)3-6(7(4)11)8(18)17-9(15)16;/h2-3H,1H3,(H4,15,16,17,18);1H |
| InChIKey | JECCCYHYVJVZDD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.11 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|