C14H10F6N4O2 — CID 146033793
3-amino-5-[3,5-bis(trifluoromethyl)phenyl]-N-(diaminomethylidene)furan-2-carboxamide (PubChem CID 146033793) has the molecular formula C14H10F6N4O2 and a molecular weight of 380.25 g/mol. Its IUPAC name is 3-amino-5-[3,5-bis(trifluoromethyl)phenyl]-N-(diaminomethylidene)furan-2-carboxamide.
| Compound Name | 3-amino-5-[3,5-bis(trifluoromethyl)phenyl]-N-(diaminomethylidene)furan-2-carboxamide |
|---|---|
| PubChem CID | 146033793 |
| Molecular Formula | C14H10F6N4O2 |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 3-amino-5-[3,5-bis(trifluoromethyl)phenyl]-N-(diaminomethylidene)furan-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1oc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1N |
| InChI | InChI=1S/C14H10F6N4O2/c15-13(16,17)6-1-5(2-7(3-6)14(18,19)20)9-4-8(21)10(26-9)11(25)24-12(22)23/h1-4H,21H2,(H4,22,23,24,25) |
| InChIKey | MZLXTMHEJVUNMN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 120.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|