C14H8F6N2O2 — CID 169133743
3-amino-6-[3,5-bis(trifluoromethyl)phenyl]pyridine-2-carboxylic acid (PubChem CID 169133743) has the molecular formula C14H8F6N2O2 and a molecular weight of 350.22 g/mol. Its IUPAC name is 3-amino-6-[3,5-bis(trifluoromethyl)phenyl]pyridine-2-carboxylic acid.
| Compound Name | 3-amino-6-[3,5-bis(trifluoromethyl)phenyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 169133743 |
| Molecular Formula | C14H8F6N2O2 |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 3-amino-6-[3,5-bis(trifluoromethyl)phenyl]pyridine-2-carboxylic acid |
| SMILES | Nc1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)nc1C(=O)O |
| InChI | InChI=1S/C14H8F6N2O2/c15-13(16,17)7-3-6(4-8(5-7)14(18,19)20)10-2-1-9(21)11(22-10)12(23)24/h1-5H,21H2,(H,23,24) |
| InChIKey | WQCYIVHWMLCPLA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |