C12H5Cl5N2O2 — CID 134624256
3-amino-6-(2,3,4,5,6-pentachlorophenyl)pyridine-2-carboxylic acid (PubChem CID 134624256) has the molecular formula C12H5Cl5N2O2 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-amino-6-(2,3,4,5,6-pentachlorophenyl)pyridine-2-carboxylic acid.
| Compound Name | 3-amino-6-(2,3,4,5,6-pentachlorophenyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 134624256 |
| Molecular Formula | C12H5Cl5N2O2 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 383.88 |
| IUPAC Name | 3-amino-6-(2,3,4,5,6-pentachlorophenyl)pyridine-2-carboxylic acid |
| SMILES | Nc1ccc(-c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)nc1C(=O)O |
| InChI | InChI=1S/C12H5Cl5N2O2/c13-6-5(7(14)9(16)10(17)8(6)15)4-2-1-3(18)11(19-4)12(20)21/h1-2H,18H2,(H,20,21) |
| InChIKey | XBWVBTTXDHYLRI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|