C11H7Cl2N3O2 — CID 22677268
4-amino-3-chloro-6-(6-chloro-3-pyridinyl)pyridine-2-carboxylic acid (PubChem CID 22677268) has the molecular formula C11H7Cl2N3O2 and a molecular weight of 284.10 g/mol. Its IUPAC name is 4-amino-3-chloro-6-(6-chloro-3-pyridinyl)pyridine-2-carboxylic acid.
| Compound Name | 4-amino-3-chloro-6-(6-chloro-3-pyridinyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 22677268 |
| Molecular Formula | C11H7Cl2N3O2 |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 4-amino-3-chloro-6-(6-chloro-3-pyridinyl)pyridine-2-carboxylic acid |
| SMILES | Nc1cc(-c2ccc(Cl)nc2)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C11H7Cl2N3O2/c12-8-2-1-5(4-15-8)7-3-6(14)9(13)10(16-7)11(17)18/h1-4H,(H2,14,16)(H,17,18) |
| InChIKey | VTUWKOXCVAMCNP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|