C14H13ClN2O5S — CID 151134828
4-amino-3-chloro-6-[4-methyl-3-(sulfomethyl)phenyl]pyridine-2-carboxylic acid (PubChem CID 151134828) has the molecular formula C14H13ClN2O5S and a molecular weight of 356.79 g/mol. Its IUPAC name is 4-amino-3-chloro-6-[4-methyl-3-(sulfomethyl)phenyl]pyridine-2-carboxylic acid.
| Compound Name | 4-amino-3-chloro-6-[4-methyl-3-(sulfomethyl)phenyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 151134828 |
| Molecular Formula | C14H13ClN2O5S |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 4-amino-3-chloro-6-[4-methyl-3-(sulfomethyl)phenyl]pyridine-2-carboxylic acid |
| SMILES | Cc1ccc(-c2cc(N)c(Cl)c(C(=O)O)n2)cc1CS(=O)(=O)O |
| InChI | InChI=1S/C14H13ClN2O5S/c1-7-2-3-8(4-9(7)6-23(20,21)22)11-5-10(16)12(15)13(17-11)14(18)19/h2-5H,6H2,1H3,(H2,16,17)(H,18,19)(H,20,21,22) |
| InChIKey | MUZKVQVXUZPJDN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 130.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|