About 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid
4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid (PubChem CID 68598493) has the molecular formula C14H11ClF2N2O6
and a molecular weight of 376.70 g/mol. Its IUPAC name is 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid |
| PubChem CID | 68598493 |
| Molecular Formula | C14H11ClF2N2O6 |
| Molecular Weight | 376.70 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid |
| SMILES | Nc1cc(-c2ccc(C(O)(O)F)c(C(O)(O)F)c2)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C14H11ClF2N2O6/c15-10-8(18)4-9(19-11(10)12(20)21)5-1-2-6(13(16,22)23)7(3-5)14(17,24)25/h1-4,22-25H,(H2,18,19)(H,20,21) |
| InChIKey | JFWCGXQAHYUNBH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.70 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid?
The IUPAC name of 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid (CID 68598493) is 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid.
What is the SMILES notation for 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid?
The canonical SMILES for 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid is Nc1cc(-c2ccc(C(O)(O)F)c(C(O)(O)F)c2)nc(C(=O)O)c1Cl.
What is the InChIKey of 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid?
The InChIKey is JFWCGXQAHYUNBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClF2N2O6/c15-10-8(18)4-9(19-11(10)12(20)21)5-1-2-6(13(16,22)23)7(3-5)14(17,24)25/h1-4,22-25H,(H2,18,19)(H,20,21).
What are the key properties of 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid?
4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid has a molecular weight of 376.70 g/mol, XLogP of 0.81, 4 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid is sourced from PubChem (CID 68598493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).