C14H11ClF2N2O6 — CID 68598493
4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid (PubChem CID 68598493) has the molecular formula C14H11ClF2N2O6 and a molecular weight of 376.70 g/mol. Its IUPAC name is 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid.
| Compound Name | 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 68598493 |
| Molecular Formula | C14H11ClF2N2O6 |
| Molecular Weight | 376.70 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylic acid |
| SMILES | Nc1cc(-c2ccc(C(O)(O)F)c(C(O)(O)F)c2)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C14H11ClF2N2O6/c15-10-8(18)4-9(19-11(10)12(20)21)5-1-2-6(13(16,22)23)7(3-5)14(17,24)25/h1-4,22-25H,(H2,18,19)(H,20,21) |
| InChIKey | JFWCGXQAHYUNBH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.70 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|