C15H13ClF2N2O6 — CID 68600822
methyl 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylate (PubChem CID 68600822) has the molecular formula C15H13ClF2N2O6 and a molecular weight of 390.73 g/mol. Its IUPAC name is methyl 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylate.
| Compound Name | methyl 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 68600822 |
| Molecular Formula | C15H13ClF2N2O6 |
| Molecular Weight | 390.73 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | methyl 4-amino-6-[3,4-bis[fluoro(dihydroxy)methyl]phenyl]-3-chloropyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(C(O)(O)F)c(C(O)(O)F)c2)cc(N)c1Cl |
| InChI | InChI=1S/C15H13ClF2N2O6/c1-26-13(21)12-11(16)9(19)5-10(20-12)6-2-3-7(14(17,22)23)8(4-6)15(18,24)25/h2-5,22-25H,1H3,(H2,19,20) |
| InChIKey | WSWOAFMIQUBSMY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 146.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.73 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|