C14H10ClF3N2O3 — CID 22677364
methyl 4-amino-3-chloro-6-[4-(trifluoromethoxy)phenyl]pyridine-2-carboxylate (PubChem CID 22677364) has the molecular formula C14H10ClF3N2O3 and a molecular weight of 346.69 g/mol. Its IUPAC name is methyl 4-amino-3-chloro-6-[4-(trifluoromethoxy)phenyl]pyridine-2-carboxylate.
| Compound Name | methyl 4-amino-3-chloro-6-[4-(trifluoromethoxy)phenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 22677364 |
| Molecular Formula | C14H10ClF3N2O3 |
| Molecular Weight | 346.69 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | methyl 4-amino-3-chloro-6-[4-(trifluoromethoxy)phenyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(OC(F)(F)F)cc2)cc(N)c1Cl |
| InChI | InChI=1S/C14H10ClF3N2O3/c1-22-13(21)12-11(15)9(19)6-10(20-12)7-2-4-8(5-3-7)23-14(16,17)18/h2-6H,1H3,(H2,19,20) |
| InChIKey | HLWXWPRWHWTPEQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.69 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |