C12H9Cl2N3O2 — CID 22677295
methyl 4-amino-3-chloro-6-(6-chloro-3-pyridinyl)pyridine-2-carboxylate (PubChem CID 22677295) has the molecular formula C12H9Cl2N3O2 and a molecular weight of 298.13 g/mol. Its IUPAC name is methyl 4-amino-3-chloro-6-(6-chloro-3-pyridinyl)pyridine-2-carboxylate.
| Compound Name | methyl 4-amino-3-chloro-6-(6-chloro-3-pyridinyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 22677295 |
| Molecular Formula | C12H9Cl2N3O2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | methyl 4-amino-3-chloro-6-(6-chloro-3-pyridinyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(Cl)nc2)cc(N)c1Cl |
| InChI | InChI=1S/C12H9Cl2N3O2/c1-19-12(18)11-10(14)7(15)4-8(17-11)6-2-3-9(13)16-5-6/h2-5H,1H3,(H2,15,17) |
| InChIKey | QKHOVFYLNMLNHD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|