C13H7Cl2F3N2O2 — CID 22677250
4-amino-3-chloro-6-[4-chloro-2-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid (PubChem CID 22677250) has the molecular formula C13H7Cl2F3N2O2 and a molecular weight of 351.11 g/mol. Its IUPAC name is 4-amino-3-chloro-6-[4-chloro-2-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid.
| Compound Name | 4-amino-3-chloro-6-[4-chloro-2-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 22677250 |
| Molecular Formula | C13H7Cl2F3N2O2 |
| Molecular Weight | 351.11 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 4-amino-3-chloro-6-[4-chloro-2-(trifluoromethyl)phenyl]pyridine-2-carboxylic acid |
| SMILES | Nc1cc(-c2ccc(Cl)cc2C(F)(F)F)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C13H7Cl2F3N2O2/c14-5-1-2-6(7(3-5)13(16,17)18)9-4-8(19)10(15)11(20-9)12(21)22/h1-4H,(H2,19,20)(H,21,22) |
| InChIKey | BOUTZRLVXJRSJH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.11 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |